ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6832 CAS 1138444-09-3



3-CYANO-5-METHOXYISONICOTINIC ACID
CAS 1138444-09-3
ID 6832

Molecular Formula   C8H6N2O3
Molecular Weight     178.147
SmileCode               COC1=C(C(=CN=C1)C#N)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com