ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6840 CAS 1138444-19-5



TERT-BUTYL 3-CYANO-5-METHOXYPYRIDIN-4-YLCARBAMATE
CAS 1138444-19-5
ID 6840

Molecular Formula   C12H15N3O3
Molecular Weight     249.270
SmileCode               CC(C)(C)OC(=O)NC1=C(C=NC=C1C#N)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com