ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6849 CAS 1138444-30-0



TERT-BUTYL 2,5-DIIODOPYRIDIN-3-YL CARBONATE
CAS 1138444-30-0
ID 6849

Molecular Formula   C10H11I2NO3
Molecular Weight     447.011
SmileCode               CC(C)(C)OC(=O)OC1=CC(=CN=C1I)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com