ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6851 CAS 113975-31-8



N-(3-IODO-PYRIDIN-2-YL)-2,2-DIMETHYL-PROPIONAMIDE
CAS 113975-31-8
ID 6851

Molecular Formula   C10H13IN2O
Molecular Weight     304.131
SmileCode               CC(C)(C)C(=O)NC1=C(C=CC=N1)I

Quantity | Price        5g | 820 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com