ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6864 CAS 1142191-73-8



METHYL 3-(2-CHLORO-4-IODOPYRIDIN-3-YL)ACRYLATE
CAS 1142191-73-8
ID 6864

Molecular Formula   C9H7ClINO2
Molecular Weight     323.514
SmileCode               COC(=O)C=CC1=C(C=CN=C1Cl)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com