ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6865 CAS 1142191-74-9



N-(2-CHLORO-6-(TRIMETHYLSILYL)PYRIDIN-3-YL)PIVALAMIDE
CAS 1142191-74-9
ID 6865

Molecular Formula   C13H21ClN2OSi
Molecular Weight     284.859
SmileCode               CC(C)(C)C(=O)NC1=C(N=C(C=C1)[Si](C)(C)C)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com