ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6871 CAS 1142191-85-2



6-BROMO-2-CHLORO-3-(TRIMETHYLSILYL)PYRIDINE
CAS 1142191-85-2
ID 6871

Molecular Formula   C8H11BrClNSi
Molecular Weight     264.622
SmileCode               C[Si](C)(C)C1=C(N=C(C=C1)Br)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com