ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6872 CAS 1142191-86-3



TERT-BUTYL (4-CYANO-5-METHOXYPYRIDIN-3-YL)METHYLCARBAMATE
CAS 1142191-86-3
ID 6872

Molecular Formula   C13H17N3O3
Molecular Weight     263.297
SmileCode               CC(C)(C)OC(=O)NCC1=CN=CC(=C1C#N)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com