ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6874 CAS 1142191-90-9



N-(2-CHLORO-6-CYANOPYRIDIN-3-YL)PIVALAMIDE
CAS 1142191-90-9
ID 6874

Molecular Formula   C11H12ClN3O
Molecular Weight     237.687
SmileCode               CC(C)(C)C(=O)NC1=C(N=C(C=C1)C#N)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com