ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6876 CAS 1142191-94-3



N-(6-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)-2-CHLOROPYRIDIN-3-YL)PIVALAMIDE
CAS 1142191-94-3
ID 6876

Molecular Formula   C17H29ClN2O2Si
Molecular Weight     356.966
SmileCode               CC(C)(C)C(=O)NC1=C(N=C(C=C1)CO[Si](C)(C)C(C)(C)C)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com