ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6886 CAS 1142192-12-8



6-BROMO-2-CHLORO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS 1142192-12-8
ID 6886

Molecular Formula   C8H8BrClN2O2
Molecular Weight     279.518
SmileCode               CN(C(=O)C1=C(N=C(C=C1)Br)Cl)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com