ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6896 CAS 1142192-57-1



3-IODO-5-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1142192-57-1
ID 6896

Molecular Formula   C8H4F3IN2
Molecular Weight     312.034
SmileCode               C1=C2C(=CNC2=NC=C1C(F)(F)F)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com