ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6897 CAS 1142192-58-2



4,5-DICHLORO-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1142192-58-2
ID 6897

Molecular Formula   C7H4Cl2N2
Molecular Weight     187.023
SmileCode               C1=CNC2=NC=C(C(=C21)Cl)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com