ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6902 CAS 115687-29-1



1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID AMIDE
CAS 115687-29-1
ID 6902

Molecular Formula   C12H16N2O
Molecular Weight     204.273
SmileCode               C1CN(CC1C(=O)N)CC2=CC=CC=C2

Quantity | Price        5g | 940 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com