ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6903 CAS 116026-98-3



(2-BROMO-PYRIDIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS 116026-98-3
ID 6903

Molecular Formula   C10H13BrN2O2
Molecular Weight     273.130
SmileCode               CC(C)(C)OC(=O)NC1=C(N=CC=C1)Br

Quantity | Price        5g | 370 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com