ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6904 CAS 116026-99-4



(2-FORMYL-PYRIDIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS 116026-99-4
ID 6904

Molecular Formula   C11H14N2O3
Molecular Weight     222.244
SmileCode               CC(C)(C)OC(=O)NC1=C(N=CC=C1)C=O

Quantity | Price        5g | 1010 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com