ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6912 CAS 1171920-02-7



N-(2-BROMO-5-CYANOPYRIDIN-3-YL)PIVALAMIDE
CAS 1171920-02-7
ID 6912

Molecular Formula   C11H12BrN3O
Molecular Weight     282.141
SmileCode               CC(C)(C)C(=O)NC1=C(N=CC(=C1)C#N)Br

Quantity | Price        5g | 2410 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com