ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6917 CAS 1171920-21-0



6-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)FURO[3,2-B]PYRIDINE
CAS 1171920-21-0
ID 6917

Molecular Formula   C14H21NO2Si
Molecular Weight     263.412
SmileCode               CC(C)(C)[Si](C)(C)OCC1=CC2=C(C=CO2)N=C1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com