ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6935 CAS 1171920-66-3



3-METHYL-6-(TRIMETHYLSILYL)-3H-IMIDAZO[4,5-B]PYRIDINE
CAS 1171920-66-3
ID 6935

Molecular Formula   C10H15N3Si
Molecular Weight     205.336
SmileCode               CN1C=NC2=CC(=CN=C21)[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com