ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6938 CAS 1171920-73-2



3-(3-METHYL-3H-IMIDAZO[4,5-B]PYRIDIN-6-YL)PROP-2-YN-1-OL
CAS 1171920-73-2
ID 6938

Molecular Formula   C10H9N3O
Molecular Weight     187.202
SmileCode               CN1C=NC2=C1N=CC(=C2)C#CCO

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com