ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6939 CAS 1171920-75-4



7-BROMO-2-(CHLOROMETHYL)-1-METHYL-1H-IMIDAZO[4,5-C]PYRIDINE
CAS 1171920-75-4
ID 6939

Molecular Formula   C8H7BrClN3
Molecular Weight     260.519
SmileCode               CN1C(=NC2=CN=CC(=C21)Br)CCl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com