ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6958 CAS 1186310-90-6



2-(TRIMETHYLSILYL)FURO[3,2-B]PYRIDIN-6-OL
CAS 1186310-90-6
ID 6958

Molecular Formula   C10H13NO2Si
Molecular Weight     207.304
SmileCode               C[Si](C)(C)C1=CC2=NC=C(C=C2O1)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com