ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6962 CAS 1186310-94-0



6-BROMO-2-(CHLOROMETHYL)FURO[3,2-B]PYRIDINE
CAS 1186310-94-0
ID 6962

Molecular Formula   C8H5BrClNO
Molecular Weight     246.488
SmileCode               C1=C(OC2=CC(=CN=C21)Br)CCl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com