ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6967 CAS 1186311-03-4



4-METHOXY-1-(TRIISOPROPYLSILYL)-1H-PYRROLO[2,3-C]PYRIDINE
CAS 1186311-03-4
ID 6967

Molecular Formula   C17H28N2OSi
Molecular Weight     304.509
SmileCode               CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C=NC=C21)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com