ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6972 CAS 1186311-14-7



6-(DIMETHOXYMETHYL)-3-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS 1186311-14-7
ID 6972

Molecular Formula   C10H13N3O2
Molecular Weight     207.233
SmileCode               CN1C=NC2=C1N=CC(=C2)C(OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com