ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6973 CAS 1186311-15-8



6-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)-3-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS 1186311-15-8
ID 6973

Molecular Formula   C14H23N3OSi
Molecular Weight     277.443
SmileCode               CC(C)(C)[Si](C)(C)OCC1=CC2=C(N=C1)N(C=N2)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com