ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6974 CAS 1186311-17-0



TERT-BUTYL 6-((TERT-BUTOXYCARBONYLAMINO)METHYL)-2-HYDROXY-3-METHYL-2,3-DIHYDRO-1H-IMIDAZO[4,5-B]PYRIDINE-1-CARBOXYLATE
CAS 1186311-17-0
ID 6974

Molecular Formula   C18H28N4O5
Molecular Weight     380.445
SmileCode               CC(C)(C)OC(=O)NCC1=CC2=C(N=C1)N(C(N2C(=O)OC(C)(C)C)O)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com