ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6977 CAS 1186405-19-5



2-(TRIMETHYLSILYL)FURO[3,2-B]PYRIDINE-6-CARBALDEHYDE OXIME
CAS 1186405-19-5
ID 6977

Molecular Formula   C11H14N2O2Si
Molecular Weight     234.330
SmileCode               C[Si](C)(C)C1=CC2=C(O1)C=C(C=N2)C=NO

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com