ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6979 CAS 1186405-22-0



(E)-METHYL 3-(3-METHYL-3H-IMIDAZO[4,5-B]PYRIDIN-6-YL)ACRYLATE
CAS 1186405-22-0
ID 6979

Molecular Formula   C11H11N3O2
Molecular Weight     217.228
SmileCode               CN1C=NC2=C1N=CC(=C2)C=CC(=O)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com