ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6981 CAS 1188539-34-5



6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)FURO[3,2-B]PYRIDINE
CAS 1188539-34-5
ID 6981

Molecular Formula   C13H16BNO3
Molecular Weight     245.085
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CO3)N=C2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com