ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6982 CAS 1188926-86-4



6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2-(TRIMETHYLSILYL)FURO[3,2-B]PYRIDINE
CAS 1188926-86-4
ID 6982

Molecular Formula   C16H24BNO3Si
Molecular Weight     317.267
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(O3)[Si](C)(C)C)N=C2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com