ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7000 CAS 1198095-99-6



5-METHYL-1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID
CAS 1198095-99-6
ID 7000

Molecular Formula   C9H8N2O2
Molecular Weight     176.175
SmileCode               CC1=CN=C2C(=C1)C(=CN2)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com