ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7006 CAS 1198097-05-0



7-CHLORO-5-IODO-1-(TRIISOPROPYLSILYL)-1H-PYRROLO[2,3-C]PYRIDINE
CAS 1198097-05-0
ID 7006

Molecular Formula   C16H24ClIN2Si
Molecular Weight     434.821
SmileCode               CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=CC(=NC(=C21)Cl)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com