ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7012 CAS 1198098-45-1



3-ALLYL-5-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1198098-45-1
ID 7012

Molecular Formula   C11H12N2
Molecular Weight     172.231
SmileCode               CC1=CN=C2C(=C1)C(=CN2)CC=C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com