ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7019 CAS 1198107-00-4



TERT-BUTYL (5-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-3-YL)METHYLCARBAMATE
CAS 1198107-00-4
ID 7019

Molecular Formula   C14H19N3O2
Molecular Weight     261.325
SmileCode               CC1=CN=C2C(=C1)C(=CN2)CNC(=O)OC(C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com