ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7020 CAS 1198108-82-5



TERT-BUTYL 7-IODO-2H-PYRIDO[3,2-B][1,4]OXAZINE-4(3H)-CARBOXYLATE
CAS 1198108-82-5
ID 7020

Molecular Formula   C12H15IN2O3
Molecular Weight     362.167
SmileCode               CC(C)(C)OC(=O)N1CCOC2=CC(=CN=C21)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com