ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7024 CAS 1198425-67-0



6-(3-HYDROXYPROP-1-YNYL)-1-(4-METHOXYBENZYL)-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1198425-67-0
ID 7024

Molecular Formula   C18H16N2O4
Molecular Weight     324.336
SmileCode               COC1=CC=C(C=C1)CN2C(=O)COC3=C2C=CC(=N3)C#CCO

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com