ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7030 CAS 1203498-99-0



5-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID
CAS 1203498-99-0
ID 7030

Molecular Formula   C8H5ClN2O2
Molecular Weight     196.590
SmileCode               C1=C2C(=CNC2=NC=C1Cl)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com