ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7032 CAS 1203499-02-8



5-METHYL-2-PIVALAMIDONICOTINIC ACID
CAS 1203499-02-8
ID 7032

Molecular Formula   C12H16N2O3
Molecular Weight     236.271
SmileCode               CC1=CN=C(C(=C1)C(=O)O)NC(=O)C(C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com