ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7036 CAS 1203499-09-5



3-(3-(BENZYLOXY)PYRIDIN-2-YL)PROP-2-YN-1-OL
CAS 1203499-09-5
ID 7036

Molecular Formula   C15H13NO2
Molecular Weight     239.274
SmileCode               C1=CC=C(C=C1)COC2=C(N=CC=C2)C#CCO

Quantity | Price        5g | 2470 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com