ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7037 CAS 1203499-11-9



N-(3-HYDROXY-5-METHYLPYRIDIN-2-YL)PIVALAMIDE
CAS 1203499-11-9
ID 7037

Molecular Formula   C11H16N2O2
Molecular Weight     208.261
SmileCode               CC1=CC(=C(N=C1)NC(=O)C(C)(C)C)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com