ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7041 CAS 1203499-18-6



TERT-BUTYL (2-CHLORO-5-METHYLPYRIDIN-3-YL)METHYLCARBAMATE
CAS 1203499-18-6
ID 7041

Molecular Formula   C12H17ClN2O2
Molecular Weight     256.730
SmileCode               CC1=CC(=C(N=C1)Cl)CNC(=O)OC(C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com