ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7045 CAS 1203499-22-2



2-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-3-IODO-5-METHYLPYRIDINE
CAS 1203499-22-2
ID 7045

Molecular Formula   C17H29IN2OSi
Molecular Weight     432.421
SmileCode               CC1=CC(=C(N=C1)N2CCC(C2)CO[Si](C)(C)C(C)(C)C)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com