ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7048 CAS 1203499-25-5



6-IODO-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1203499-25-5
ID 7048

Molecular Formula   C7H5IN2O2
Molecular Weight     276.033
SmileCode               C1C(=O)NC2=C(O1)N=C(C=C2)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com