ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7056 CAS 1203499-33-5



TERT-BUTYL 3-((3-IODO-5-METHYLPYRIDIN-2-YLOXY)METHYL)PYRROLIDINE-1-CARBOXYLATE
CAS 1203499-33-5
ID 7056

Molecular Formula   C16H23IN2O3
Molecular Weight     418.275
SmileCode               CC1=CC(=C(N=C1)OCC2CCN(C2)C(=O)OC(C)(C)C)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com