ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7058 CAS 1203499-36-8



8-IODO-1-(4-METHOXYBENZYL)-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1203499-36-8
ID 7058

Molecular Formula   C15H13IN2O3
Molecular Weight     396.184
SmileCode               COC1=CC=C(C=C1)CN2C(=O)COC3=NC=CC(=C32)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com