ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7063 CAS 1203499-41-5



6-(3-HYDROXYPROP-1-YNYL)-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1203499-41-5
ID 7063

Molecular Formula   C10H8N2O3
Molecular Weight     204.185
SmileCode               C1C(=O)NC2=C(O1)N=C(C=C2)C#CCO

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com