ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7064 CAS 1203499-42-6



6-((TRIMETHYLSILYL)ETHYNYL)-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1203499-42-6
ID 7064

Molecular Formula   C12H14N2O2Si
Molecular Weight     246.341
SmileCode               C[Si](C)(C)C#CC1=NC2=C(C=C1)NC(=O)CO2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com