ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7065 CAS 1203499-43-7



TERT-BUTYL 3,4-DICHLOROPYRIDIN-2-YLCARBAMATE
CAS 1203499-43-7
ID 7065

Molecular Formula   C10H12Cl2N2O2
Molecular Weight     263.118
SmileCode               CC(C)(C)OC(=O)NC1=NC=CC(=C1Cl)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com