ID 7081 CAS 1203499-66-4

CAS 1203499-66-4
ID 7081

Molecular Formula   C11H14N2O2
Molecular Weight     206.245
SmileCode               CC(C)(C)N1C(=O)COC2=C1C=CC=N2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock

Inquiry : contact[at]